C17H26O — CID 142281411
propane;(3Z,7Z)-5,6,9-trimethylideneundeca-1,3,7-trien-2-ol (PubChem CID 142281411) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is propane;(3Z,7Z)-5,6,9-trimethylideneundeca-1,3,7-trien-2-ol.
| Compound Name | propane;(3Z,7Z)-5,6,9-trimethylideneundeca-1,3,7-trien-2-ol |
|---|---|
| PubChem CID | 142281411 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | propane;(3Z,7Z)-5,6,9-trimethylideneundeca-1,3,7-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)C(=C)/C=C/C(=C)CC.CCC |
| InChI | InChI=1S/C14H18O.C3H8/c1-6-11(2)7-8-12(3)13(4)9-10-14(5)15;1-3-2/h7-10,15H,2-6H2,1H3;3H2,1-2H3/b8-7-,10-9-; |
| InChIKey | YBHJBHNCULPYAM-CGGPWJJTSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|