C9H13ClO — CID 142113261
(2Z,4Z)-2-chloro-6-methylideneocta-2,4-dien-3-ol (PubChem CID 142113261) has the molecular formula C9H13ClO and a molecular weight of 172.65 g/mol. Its IUPAC name is (2Z,4Z)-2-chloro-6-methylideneocta-2,4-dien-3-ol.
| Compound Name | (2Z,4Z)-2-chloro-6-methylideneocta-2,4-dien-3-ol |
|---|---|
| PubChem CID | 142113261 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.65 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (2Z,4Z)-2-chloro-6-methylideneocta-2,4-dien-3-ol |
| SMILES | C=C(/C=C\C(O)=C(/C)Cl)CC |
| InChI | InChI=1S/C9H13ClO/c1-4-7(2)5-6-9(11)8(3)10/h5-6,11H,2,4H2,1,3H3/b6-5-,9-8- |
| InChIKey | YHQOADYIYNDJNU-AFJQJTPPSA-N |
| XLogP | 3.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|