About methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene
methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene (PubChem CID 145083529) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene.
Molecular Properties
| Compound Name | methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene |
| PubChem CID | 145083529 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene |
| SMILES | C.C=C(/C=C\C=C(C)C)CC |
| InChI | InChI=1S/C10H16.CH4/c1-5-10(4)8-6-7-9(2)3;/h6-8H,4-5H2,1-3H3;1H4/b8-6-; |
| InChIKey | ZFPYYYMWAFZILW-PHZXCRFESA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene?
The IUPAC name of methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene (CID 145083529) is methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene.
What is the SMILES notation for methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene?
The canonical SMILES for methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene is C.C=C(/C=C\C=C(C)C)CC.
What is the InChIKey of methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene?
The InChIKey is ZFPYYYMWAFZILW-PHZXCRFESA-N. The full InChI is InChI=1S/C10H16.CH4/c1-5-10(4)8-6-7-9(2)3;/h6-8H,4-5H2,1-3H3;1H4/b8-6-;.
What are the key properties of methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene?
methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene has a molecular weight of 152.28 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene is sourced from PubChem (CID 145083529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).