C11H20 — CID 145083529
methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene (PubChem CID 145083529) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene.
| Compound Name | methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene |
|---|---|
| PubChem CID | 145083529 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | methane;(4Z)-2-methyl-6-methylideneocta-2,4-diene |
| SMILES | C.C=C(/C=C\C=C(C)C)CC |
| InChI | InChI=1S/C10H16.CH4/c1-5-10(4)8-6-7-9(2)3;/h6-8H,4-5H2,1-3H3;1H4/b8-6-; |
| InChIKey | ZFPYYYMWAFZILW-PHZXCRFESA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|