About (3Z)-2-bromo-6-methylhepta-1,3,5-triene
(3Z)-2-bromo-6-methylhepta-1,3,5-triene (PubChem CID 118586502) has the molecular formula C8H11Br
and a molecular weight of 187.08 g/mol. Its IUPAC name is (3Z)-2-bromo-6-methylhepta-1,3,5-triene.
Molecular Properties
| Compound Name | (3Z)-2-bromo-6-methylhepta-1,3,5-triene |
| PubChem CID | 118586502 |
| Molecular Formula | C8H11Br |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | (3Z)-2-bromo-6-methylhepta-1,3,5-triene |
| SMILES | C=C(Br)/C=C\C=C(C)C |
| InChI | InChI=1S/C8H11Br/c1-7(2)5-4-6-8(3)9/h4-6H,3H2,1-2H3/b6-4- |
| InChIKey | NPKFYDXDSWAVFH-XQRVVYSFSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-bromo-6-methylhepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-bromo-6-methylhepta-1,3,5-triene?
The IUPAC name of (3Z)-2-bromo-6-methylhepta-1,3,5-triene (CID 118586502) is (3Z)-2-bromo-6-methylhepta-1,3,5-triene.
What is the SMILES notation for (3Z)-2-bromo-6-methylhepta-1,3,5-triene?
The canonical SMILES for (3Z)-2-bromo-6-methylhepta-1,3,5-triene is C=C(Br)/C=C\C=C(C)C.
What is the InChIKey of (3Z)-2-bromo-6-methylhepta-1,3,5-triene?
The InChIKey is NPKFYDXDSWAVFH-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H11Br/c1-7(2)5-4-6-8(3)9/h4-6H,3H2,1-2H3/b6-4-.
What are the key properties of (3Z)-2-bromo-6-methylhepta-1,3,5-triene?
(3Z)-2-bromo-6-methylhepta-1,3,5-triene has a molecular weight of 187.08 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-bromo-6-methylhepta-1,3,5-triene is sourced from PubChem (CID 118586502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).