C8H11Br — CID 118586502
(3Z)-2-bromo-6-methylhepta-1,3,5-triene (PubChem CID 118586502) has the molecular formula C8H11Br and a molecular weight of 187.08 g/mol. Its IUPAC name is (3Z)-2-bromo-6-methylhepta-1,3,5-triene.
| Compound Name | (3Z)-2-bromo-6-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 118586502 |
| Molecular Formula | C8H11Br |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | (3Z)-2-bromo-6-methylhepta-1,3,5-triene |
| SMILES | C=C(Br)/C=C\C=C(C)C |
| InChI | InChI=1S/C8H11Br/c1-7(2)5-4-6-8(3)9/h4-6H,3H2,1-2H3/b6-4- |
| InChIKey | NPKFYDXDSWAVFH-XQRVVYSFSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|