C19H34 — CID 143867718
(4Z)-7,8-diethyl-2,7,8,9-tetramethyl-6-methylidenedeca-2,4-diene (PubChem CID 143867718) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is (4Z)-7,8-diethyl-2,7,8,9-tetramethyl-6-methylidenedeca-2,4-diene.
| Compound Name | (4Z)-7,8-diethyl-2,7,8,9-tetramethyl-6-methylidenedeca-2,4-diene |
|---|---|
| PubChem CID | 143867718 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | (4Z)-7,8-diethyl-2,7,8,9-tetramethyl-6-methylidenedeca-2,4-diene |
| SMILES | C=C(/C=C\C=C(C)C)C(C)(CC)C(C)(CC)C(C)C |
| InChI | InChI=1S/C19H34/c1-10-18(8,16(5)6)19(9,11-2)17(7)14-12-13-15(3)4/h12-14,16H,7,10-11H2,1-6,8-9H3/b14-12- |
| InChIKey | OPHZCOLNZREIHO-OWBHPGMISA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|