C18H38 — CID 143356307
butane;(4Z)-3,7-dimethylocta-1,4,6-triene;ethane (PubChem CID 143356307) has the molecular formula C18H38 and a molecular weight of 254.50 g/mol. Its IUPAC name is butane;(4Z)-3,7-dimethylocta-1,4,6-triene;ethane.
| Compound Name | butane;(4Z)-3,7-dimethylocta-1,4,6-triene;ethane |
|---|---|
| PubChem CID | 143356307 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | butane;(4Z)-3,7-dimethylocta-1,4,6-triene;ethane |
| SMILES | C=CC(C)/C=C\C=C(C)C.CC.CC.CCCC |
| InChI | InChI=1S/C10H16.C4H10.2C2H6/c1-5-10(4)8-6-7-9(2)3;1-3-4-2;2*1-2/h5-8,10H,1H2,2-4H3;3-4H2,1-2H3;2*1-2H3/b8-6-;;; |
| InChIKey | VBBMAYUNLCXUHW-DOTWGIOWSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|