C8H12 — CID 5367027
(3E)-5-methylhepta-1,3,6-triene (PubChem CID 5367027) has the molecular formula C8H12 and a molecular weight of 108.18 g/mol. Its IUPAC name is (3E)-5-methylhepta-1,3,6-triene.
| Compound Name | (3E)-5-methylhepta-1,3,6-triene |
|---|---|
| PubChem CID | 5367027 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | (3E)-5-methylhepta-1,3,6-triene |
| SMILES | C=C/C=C/C(C)C=C |
| InChI | InChI=1S/C8H12/c1-4-6-7-8(3)5-2/h4-8H,1-2H2,3H3/b7-6+ |
| InChIKey | NDRUXLROLQGDNL-VOTSOKGWSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|