C11H16 — CID 132576789
(3E,6E,8E)-5-methyldeca-1,3,6,8-tetraene (PubChem CID 132576789) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (3E,6E,8E)-5-methyldeca-1,3,6,8-tetraene.
| Compound Name | (3E,6E,8E)-5-methyldeca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 132576789 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (3E,6E,8E)-5-methyldeca-1,3,6,8-tetraene |
| SMILES | C=C/C=C/C(C)/C=C/C=C/C |
| InChI | InChI=1S/C11H16/c1-4-6-8-10-11(3)9-7-5-2/h4-11H,2H2,1,3H3/b6-4+,9-7+,10-8+ |
| InChIKey | URCOTALNTFCKHZ-FCGWLDPVSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|