C7H12O — CID 13463245
(3E)-5-methoxyhexa-1,3-diene (PubChem CID 13463245) has the molecular formula C7H12O and a molecular weight of 112.17 g/mol. Its IUPAC name is (3E)-5-methoxyhexa-1,3-diene.
| Compound Name | (3E)-5-methoxyhexa-1,3-diene |
|---|---|
| PubChem CID | 13463245 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | (3E)-5-methoxyhexa-1,3-diene |
| SMILES | C=C/C=C/C(C)OC |
| InChI | InChI=1S/C7H12O/c1-4-5-6-7(2)8-3/h4-7H,1H2,2-3H3/b6-5+ |
| InChIKey | HMFXXDINTCMACP-AATRIKPKSA-N |
| XLogP | 1.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|