C13H24O3 — CID 123228033
3,5-dimethoxy-2,4-dimethylnona-6,8-dien-1-ol (PubChem CID 123228033) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 3,5-dimethoxy-2,4-dimethylnona-6,8-dien-1-ol.
| Compound Name | 3,5-dimethoxy-2,4-dimethylnona-6,8-dien-1-ol |
|---|---|
| PubChem CID | 123228033 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3,5-dimethoxy-2,4-dimethylnona-6,8-dien-1-ol |
| SMILES | C=CC=CC(OC)C(C)C(OC)C(C)CO |
| InChI | InChI=1S/C13H24O3/c1-6-7-8-12(15-4)11(3)13(16-5)10(2)9-14/h6-8,10-14H,1,9H2,2-5H3 |
| InChIKey | PSQPYTRWHUNJJU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|