C25H46O3 — CID 59958292
(3Z,5S,7S,9S,11Z,13S)-6,8,14-trimethoxy-5,7,9,11,13,15-hexamethylhexadeca-1,3,11-triene (PubChem CID 59958292) has the molecular formula C25H46O3 and a molecular weight of 394.64 g/mol. Its IUPAC name is (3Z,5S,7S,9S,11Z,13S)-6,8,14-trimethoxy-5,7,9,11,13,15-hexamethylhexadeca-1,3,11-triene.
| Compound Name | (3Z,5S,7S,9S,11Z,13S)-6,8,14-trimethoxy-5,7,9,11,13,15-hexamethylhexadeca-1,3,11-triene |
|---|---|
| PubChem CID | 59958292 |
| Molecular Formula | C25H46O3 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.34 |
| IUPAC Name | (3Z,5S,7S,9S,11Z,13S)-6,8,14-trimethoxy-5,7,9,11,13,15-hexamethylhexadeca-1,3,11-triene |
| SMILES | C=C/C=C\[C@H](C)C(OC)[C@@H](C)C(OC)[C@@H](C)C/C(C)=C\[C@H](C)C(OC)C(C)C |
| InChI | InChI=1S/C25H46O3/c1-12-13-14-19(5)24(27-10)22(8)25(28-11)21(7)16-18(4)15-20(6)23(26-9)17(2)3/h12-15,17,19-25H,1,16H2,2-11H3/b14-13-,18-15-/t19-,20-,21-,22+,23?,24?,25?/m0/s1 |
| InChIKey | WENPHIGINHAPJZ-BCHXVDHDSA-N |
| XLogP | 6.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|