C18H32S2 — CID 89110104
(3Z,5S,6S,7S,8R,9S,11Z)-5,7,9,11-tetramethyltetradeca-1,3,11-triene-6,8-dithiol (PubChem CID 89110104) has the molecular formula C18H32S2 and a molecular weight of 312.59 g/mol. Its IUPAC name is (3Z,5S,6S,7S,8R,9S,11Z)-5,7,9,11-tetramethyltetradeca-1,3,11-triene-6,8-dithiol.
| Compound Name | (3Z,5S,6S,7S,8R,9S,11Z)-5,7,9,11-tetramethyltetradeca-1,3,11-triene-6,8-dithiol |
|---|---|
| PubChem CID | 89110104 |
| Molecular Formula | C18H32S2 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (3Z,5S,6S,7S,8R,9S,11Z)-5,7,9,11-tetramethyltetradeca-1,3,11-triene-6,8-dithiol |
| SMILES | C=C/C=C\[C@H](C)[C@H](S)[C@@H](C)[C@H](S)[C@@H](C)C/C(C)=C\CC |
| InChI | InChI=1S/C18H32S2/c1-7-9-11-14(4)17(19)16(6)18(20)15(5)12-13(3)10-8-2/h7,9-11,14-20H,1,8,12H2,2-6H3/b11-9-,13-10-/t14-,15-,16+,17-,18+/m0/s1 |
| InChIKey | XRMQHUPIRZBOAE-BBHKOGFUSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|