C27H46O4Si — CID 59891908
(2S,3R,4R,5R,6S,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyldeca-7,9-dien-1-ol (PubChem CID 59891908) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyldeca-7,9-dien-1-ol.
| Compound Name | (2S,3R,4R,5R,6S,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyldeca-7,9-dien-1-ol |
|---|---|
| PubChem CID | 59891908 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (2S,3R,4R,5R,6S,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyldeca-7,9-dien-1-ol |
| SMILES | C=C/C=C\[C@H](C)[C@@H](OCc1ccc(OC)cc1)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C27H46O4Si/c1-11-12-13-20(2)25(30-19-23-14-16-24(29-8)17-15-23)22(4)26(21(3)18-28)31-32(9,10)27(5,6)7/h11-17,20-22,25-26,28H,1,18-19H2,2-10H3/b13-12-/t20-,21-,22+,25+,26+/m0/s1 |
| InChIKey | ITMNNVMYSMMCDL-PVGXVVBPSA-N |
| XLogP | 6.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|