C6H12O3 — CID 14889025
(2S,3S)-3-methoxypent-4-ene-1,2-diol (PubChem CID 14889025) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2S,3S)-3-methoxypent-4-ene-1,2-diol.
| Compound Name | (2S,3S)-3-methoxypent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 14889025 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (2S,3S)-3-methoxypent-4-ene-1,2-diol |
| SMILES | C=C[C@H](OC)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O3/c1-3-6(9-2)5(8)4-7/h3,5-8H,1,4H2,2H3/t5-,6-/m0/s1 |
| InChIKey | NEGRAWFXJRVYNV-WDSKDSINSA-N |
| XLogP | -0.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|