C6H12O2 — CID 12755461
(2R,3S)-3-methoxypent-4-en-2-ol (PubChem CID 12755461) has the molecular formula C6H12O2 and a molecular weight of 116.16 g/mol. Its IUPAC name is (2R,3S)-3-methoxypent-4-en-2-ol.
| Compound Name | (2R,3S)-3-methoxypent-4-en-2-ol |
|---|---|
| PubChem CID | 12755461 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | (2R,3S)-3-methoxypent-4-en-2-ol |
| SMILES | C=C[C@H](OC)[C@@H](C)O |
| InChI | InChI=1S/C6H12O2/c1-4-6(8-3)5(2)7/h4-7H,1H2,2-3H3/t5-,6+/m1/s1 |
| InChIKey | YCYFZOSTZICWQH-RITPCOANSA-N |
| XLogP | 0.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|