C12H24O3 — CID 157123316
buta-1,3-diene;butane-2,3-diol;but-3-en-2-ol (PubChem CID 157123316) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is buta-1,3-diene;butane-2,3-diol;but-3-en-2-ol.
| Compound Name | buta-1,3-diene;butane-2,3-diol;but-3-en-2-ol |
|---|---|
| PubChem CID | 157123316 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | buta-1,3-diene;butane-2,3-diol;but-3-en-2-ol |
| SMILES | C=CC(C)O.C=CC=C.CC(O)C(C)O |
| InChI | InChI=1S/C4H10O2.C4H8O.C4H6/c1-3(5)4(2)6;1-3-4(2)5;1-3-4-2/h3-6H,1-2H3;3-5H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | AIFOWXYKHVEQOY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|