About methanamine;3-methylbut-1-ene
methanamine;3-methylbut-1-ene (PubChem CID 161011072) has the molecular formula C6H15N
and a molecular weight of 101.19 g/mol. Its IUPAC name is methanamine;3-methylbut-1-ene.
Molecular Properties
| Compound Name | methanamine;3-methylbut-1-ene |
| PubChem CID | 161011072 |
| Molecular Formula | C6H15N |
| Molecular Weight | 101.19 g/mol |
| Exact Mass | 101.12 |
| IUPAC Name | methanamine;3-methylbut-1-ene |
| SMILES | C=CC(C)C.CN |
| InChI | InChI=1S/C5H10.CH5N/c1-4-5(2)3;1-2/h4-5H,1H2,2-3H3;2H2,1H3 |
| InChIKey | TXCVMCSIYDOZSR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methanamine;3-methylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;3-methylbut-1-ene?
The IUPAC name of methanamine;3-methylbut-1-ene (CID 161011072) is methanamine;3-methylbut-1-ene.
What is the SMILES notation for methanamine;3-methylbut-1-ene?
The canonical SMILES for methanamine;3-methylbut-1-ene is C=CC(C)C.CN.
What is the InChIKey of methanamine;3-methylbut-1-ene?
The InChIKey is TXCVMCSIYDOZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10.CH5N/c1-4-5(2)3;1-2/h4-5H,1H2,2-3H3;2H2,1H3.
What are the key properties of methanamine;3-methylbut-1-ene?
methanamine;3-methylbut-1-ene has a molecular weight of 101.19 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;3-methylbut-1-ene is sourced from PubChem (CID 161011072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).