C19H39N — CID 145400080
(2Z,4Z)-3-tert-butyl-4-propan-2-ylhexa-2,4-diene;methanamine;3-methylbut-1-ene (PubChem CID 145400080) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is (2Z,4Z)-3-tert-butyl-4-propan-2-ylhexa-2,4-diene;methanamine;3-methylbut-1-ene.
| Compound Name | (2Z,4Z)-3-tert-butyl-4-propan-2-ylhexa-2,4-diene;methanamine;3-methylbut-1-ene |
|---|---|
| PubChem CID | 145400080 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | (2Z,4Z)-3-tert-butyl-4-propan-2-ylhexa-2,4-diene;methanamine;3-methylbut-1-ene |
| SMILES | C/C=C(C(=C/C)\C(C)(C)C)/C(C)C.C=CC(C)C.CN |
| InChI | InChI=1S/C13H24.C5H10.CH5N/c1-8-11(10(3)4)12(9-2)13(5,6)7;1-4-5(2)3;1-2/h8-10H,1-7H3;4-5H,1H2,2-3H3;2H2,1H3/b11-8-,12-9+;; |
| InChIKey | FQOMFTWTNHTWME-RXHDVUPZSA-N |
| XLogP | 5.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|