C14H26O — CID 123927287
(Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one (PubChem CID 123927287) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one.
| Compound Name | (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one |
|---|---|
| PubChem CID | 123927287 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one |
| SMILES | C/C=C(\C(=O)C(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26O/c1-9-11(14(6,7)8)12(15)10(2)13(3,4)5/h9-10H,1-8H3/b11-9+ |
| InChIKey | AQZGHBPSBVICKY-PKNBQFBNSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|