About (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one
(Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one (PubChem CID 123927287) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one.
Molecular Properties
| Compound Name | (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one |
| PubChem CID | 123927287 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one |
| SMILES | C/C=C(\C(=O)C(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26O/c1-9-11(14(6,7)8)12(15)10(2)13(3,4)5/h9-10H,1-8H3/b11-9+ |
| InChIKey | AQZGHBPSBVICKY-PKNBQFBNSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one?
The IUPAC name of (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one (CID 123927287) is (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one.
What is the SMILES notation for (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one?
The canonical SMILES for (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one is C/C=C(\C(=O)C(C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one?
The InChIKey is AQZGHBPSBVICKY-PKNBQFBNSA-N. The full InChI is InChI=1S/C14H26O/c1-9-11(14(6,7)8)12(15)10(2)13(3,4)5/h9-10H,1-8H3/b11-9+.
What are the key properties of (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one?
(Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one has a molecular weight of 210.36 g/mol, XLogP of 4.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-tert-butyl-5,6,6-trimethylhept-2-en-4-one is sourced from PubChem (CID 123927287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).