About (4S)-4,5,5-trimethylhexane-2,3-dione
(4S)-4,5,5-trimethylhexane-2,3-dione (PubChem CID 13299605) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is (4S)-4,5,5-trimethylhexane-2,3-dione.
Molecular Properties
| Compound Name | (4S)-4,5,5-trimethylhexane-2,3-dione |
| PubChem CID | 13299605 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (4S)-4,5,5-trimethylhexane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C9H16O2/c1-6(9(3,4)5)8(11)7(2)10/h6H,1-5H3/t6-/m1/s1 |
| InChIKey | XOSMNMDVLNIJDS-ZCFIWIBFSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4,5,5-trimethylhexane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,5,5-trimethylhexane-2,3-dione?
The IUPAC name of (4S)-4,5,5-trimethylhexane-2,3-dione (CID 13299605) is (4S)-4,5,5-trimethylhexane-2,3-dione.
What is the SMILES notation for (4S)-4,5,5-trimethylhexane-2,3-dione?
The canonical SMILES for (4S)-4,5,5-trimethylhexane-2,3-dione is CC(=O)C(=O)[C@@H](C)C(C)(C)C.
What is the InChIKey of (4S)-4,5,5-trimethylhexane-2,3-dione?
The InChIKey is XOSMNMDVLNIJDS-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H16O2/c1-6(9(3,4)5)8(11)7(2)10/h6H,1-5H3/t6-/m1/s1.
What are the key properties of (4S)-4,5,5-trimethylhexane-2,3-dione?
(4S)-4,5,5-trimethylhexane-2,3-dione has a molecular weight of 156.22 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,5,5-trimethylhexane-2,3-dione is sourced from PubChem (CID 13299605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).