C9H16O2 — CID 13299605
(4S)-4,5,5-trimethylhexane-2,3-dione (PubChem CID 13299605) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (4S)-4,5,5-trimethylhexane-2,3-dione.
| Compound Name | (4S)-4,5,5-trimethylhexane-2,3-dione |
|---|---|
| PubChem CID | 13299605 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (4S)-4,5,5-trimethylhexane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C9H16O2/c1-6(9(3,4)5)8(11)7(2)10/h6H,1-5H3/t6-/m1/s1 |
| InChIKey | XOSMNMDVLNIJDS-ZCFIWIBFSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|