C21H40O3 — CID 161494050
2,2,4,5,5-pentamethylhexan-3-one;2,2,5,5-tetramethylhexane-3,4-dione (PubChem CID 161494050) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is 2,2,4,5,5-pentamethylhexan-3-one;2,2,5,5-tetramethylhexane-3,4-dione.
| Compound Name | 2,2,4,5,5-pentamethylhexan-3-one;2,2,5,5-tetramethylhexane-3,4-dione |
|---|---|
| PubChem CID | 161494050 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 2,2,4,5,5-pentamethylhexan-3-one;2,2,5,5-tetramethylhexane-3,4-dione |
| SMILES | CC(C(=O)C(C)(C)C)C(C)(C)C.CC(C)(C)C(=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22O.C10H18O2/c1-8(10(2,3)4)9(12)11(5,6)7;1-9(2,3)7(11)8(12)10(4,5)6/h8H,1-7H3;1-6H3 |
| InChIKey | WFYVUJUZRCHGOZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|