C12H25O2S+ — CID 85305143
dimethyl-(2,3,5,5-tetramethyl-4-oxohexan-2-yl)oxysulfanium (PubChem CID 85305143) has the molecular formula C12H25O2S+ and a molecular weight of 233.40 g/mol. Its IUPAC name is dimethyl-(2,3,5,5-tetramethyl-4-oxohexan-2-yl)oxysulfanium.
| Compound Name | dimethyl-(2,3,5,5-tetramethyl-4-oxohexan-2-yl)oxysulfanium |
|---|---|
| PubChem CID | 85305143 |
| Molecular Formula | C12H25O2S+ |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | dimethyl-(2,3,5,5-tetramethyl-4-oxohexan-2-yl)oxysulfanium |
| SMILES | CC(C(=O)C(C)(C)C)C(C)(C)O[S+](C)C |
| InChI | InChI=1S/C12H25O2S/c1-9(10(13)11(2,3)4)12(5,6)14-15(7)8/h9H,1-8H3/q+1 |
| InChIKey | GROXRTFSTXHLKG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|