C9H20NO+ — CID 163999676
(4,4-dimethyl-3-oxopentan-2-yl)-dimethylazanium (PubChem CID 163999676) has the molecular formula C9H20NO+ and a molecular weight of 158.26 g/mol. Its IUPAC name is (4,4-dimethyl-3-oxopentan-2-yl)-dimethylazanium.
| Compound Name | (4,4-dimethyl-3-oxopentan-2-yl)-dimethylazanium |
|---|---|
| PubChem CID | 163999676 |
| Molecular Formula | C9H20NO+ |
| Molecular Weight | 158.26 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | (4,4-dimethyl-3-oxopentan-2-yl)-dimethylazanium |
| SMILES | CC(C(=O)C(C)(C)C)[NH+](C)C |
| InChI | InChI=1S/C9H19NO/c1-7(10(5)6)8(11)9(2,3)4/h7H,1-6H3/p+1 |
| InChIKey | UHVXNQLNIPSTBA-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |