C24H44N2O4 — CID 138498566
2,3,5,5-tetramethyl-4-oxo-N-[3-[(2,3,5,5-tetramethyl-4-oxohexanoyl)amino]butan-2-yl]hexanamide (PubChem CID 138498566) has the molecular formula C24H44N2O4 and a molecular weight of 424.63 g/mol. Its IUPAC name is 2,3,5,5-tetramethyl-4-oxo-N-[3-[(2,3,5,5-tetramethyl-4-oxohexanoyl)amino]butan-2-yl]hexanamide.
| Compound Name | 2,3,5,5-tetramethyl-4-oxo-N-[3-[(2,3,5,5-tetramethyl-4-oxohexanoyl)amino]butan-2-yl]hexanamide |
|---|---|
| PubChem CID | 138498566 |
| Molecular Formula | C24H44N2O4 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 2,3,5,5-tetramethyl-4-oxo-N-[3-[(2,3,5,5-tetramethyl-4-oxohexanoyl)amino]butan-2-yl]hexanamide |
| SMILES | CC(NC(=O)C(C)C(C)C(=O)C(C)(C)C)C(C)NC(=O)C(C)C(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H44N2O4/c1-13(19(27)23(7,8)9)15(3)21(29)25-17(5)18(6)26-22(30)16(4)14(2)20(28)24(10,11)12/h13-18H,1-12H3,(H,25,29)(H,26,30) |
| InChIKey | NAFWNHBOEFTAKF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |