C13H25NO2 — CID 166979510
2,2-dimethyl-N-[(2S)-2,4,4-trimethyl-3-oxopentyl]propanamide (PubChem CID 166979510) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2S)-2,4,4-trimethyl-3-oxopentyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(2S)-2,4,4-trimethyl-3-oxopentyl]propanamide |
|---|---|
| PubChem CID | 166979510 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2,2-dimethyl-N-[(2S)-2,4,4-trimethyl-3-oxopentyl]propanamide |
| SMILES | C[C@@H](CNC(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2/c1-9(10(15)12(2,3)4)8-14-11(16)13(5,6)7/h9H,8H2,1-7H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | CWFJDNIWJFIKGZ-VIFPVBQESA-N |
| XLogP | 2.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |