C9H18N2OS — CID 62667449
N-(3-amino-2-methyl-3-sulfanylidenepropyl)-2,2-dimethylpropanamide (PubChem CID 62667449) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is N-(3-amino-2-methyl-3-sulfanylidenepropyl)-2,2-dimethylpropanamide.
| Compound Name | N-(3-amino-2-methyl-3-sulfanylidenepropyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 62667449 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-(3-amino-2-methyl-3-sulfanylidenepropyl)-2,2-dimethylpropanamide |
| SMILES | CC(CNC(=O)C(C)(C)C)C(N)=S |
| InChI | InChI=1S/C9H18N2OS/c1-6(7(10)13)5-11-8(12)9(2,3)4/h6H,5H2,1-4H3,(H2,10,13)(H,11,12) |
| InChIKey | UKDJGECSBNKVGO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|