C8H16N2O4S2 — CID 62666912
methyl 2-[(3-amino-2-methyl-3-sulfanylidenepropyl)sulfamoyl]propanoate (PubChem CID 62666912) has the molecular formula C8H16N2O4S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is methyl 2-[(3-amino-2-methyl-3-sulfanylidenepropyl)sulfamoyl]propanoate.
| Compound Name | methyl 2-[(3-amino-2-methyl-3-sulfanylidenepropyl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 62666912 |
| Molecular Formula | C8H16N2O4S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | methyl 2-[(3-amino-2-methyl-3-sulfanylidenepropyl)sulfamoyl]propanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)NCC(C)C(N)=S |
| InChI | InChI=1S/C8H16N2O4S2/c1-5(7(9)15)4-10-16(12,13)6(2)8(11)14-3/h5-6,10H,4H2,1-3H3,(H2,9,15) |
| InChIKey | PPBOXNNTTDCZRQ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|