C12H18N2O5S — CID 61458401
methyl 2-[[2-(4-aminophenyl)-2-hydroxyethyl]sulfamoyl]propanoate (PubChem CID 61458401) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is methyl 2-[[2-(4-aminophenyl)-2-hydroxyethyl]sulfamoyl]propanoate.
| Compound Name | methyl 2-[[2-(4-aminophenyl)-2-hydroxyethyl]sulfamoyl]propanoate |
|---|---|
| PubChem CID | 61458401 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | methyl 2-[[2-(4-aminophenyl)-2-hydroxyethyl]sulfamoyl]propanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)NCC(O)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H18N2O5S/c1-8(12(16)19-2)20(17,18)14-7-11(15)9-3-5-10(13)6-4-9/h3-6,8,11,14-15H,7,13H2,1-2H3 |
| InChIKey | SAHAGJRMXNLWSS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|