C12H19N3O5S — CID 114461589
propan-2-yl N-[[2-(4-aminophenyl)-2-hydroxyethyl]sulfamoyl]carbamate (PubChem CID 114461589) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is propan-2-yl N-[[2-(4-aminophenyl)-2-hydroxyethyl]sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[[2-(4-aminophenyl)-2-hydroxyethyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461589 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | propan-2-yl N-[[2-(4-aminophenyl)-2-hydroxyethyl]sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NCC(O)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H19N3O5S/c1-8(2)20-12(17)15-21(18,19)14-7-11(16)9-3-5-10(13)6-4-9/h3-6,8,11,14,16H,7,13H2,1-2H3,(H,15,17) |
| InChIKey | XFMYXLIPRKOITH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|