C7H9BrF3NO2 — CID 104701210
N-(4-bromo-2-methyl-3-oxobutyl)-2,2,2-trifluoroacetamide (PubChem CID 104701210) has the molecular formula C7H9BrF3NO2 and a molecular weight of 276.05 g/mol. Its IUPAC name is N-(4-bromo-2-methyl-3-oxobutyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-bromo-2-methyl-3-oxobutyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 104701210 |
| Molecular Formula | C7H9BrF3NO2 |
| Molecular Weight | 276.05 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | N-(4-bromo-2-methyl-3-oxobutyl)-2,2,2-trifluoroacetamide |
| SMILES | CC(CNC(=O)C(F)(F)F)C(=O)CBr |
| InChI | InChI=1S/C7H9BrF3NO2/c1-4(5(13)2-8)3-12-6(14)7(9,10)11/h4H,2-3H2,1H3,(H,12,14) |
| InChIKey | QUBXVTJAUDYSSQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.05 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|