C9H13BrF3NO2 — CID 104701362
N-[2-(2-bromoacetyl)pentyl]-2,2,2-trifluoroacetamide (PubChem CID 104701362) has the molecular formula C9H13BrF3NO2 and a molecular weight of 304.11 g/mol. Its IUPAC name is N-[2-(2-bromoacetyl)pentyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(2-bromoacetyl)pentyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 104701362 |
| Molecular Formula | C9H13BrF3NO2 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-[2-(2-bromoacetyl)pentyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCC(CNC(=O)C(F)(F)F)C(=O)CBr |
| InChI | InChI=1S/C9H13BrF3NO2/c1-2-3-6(7(15)4-10)5-14-8(16)9(11,12)13/h6H,2-5H2,1H3,(H,14,16) |
| InChIKey | LQISAOLZLZHCPN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|