C8H11BrF3NO4S — CID 104700639
N-(1-bromo-5-methylsulfonyl-2-oxopentan-3-yl)-2,2,2-trifluoroacetamide (PubChem CID 104700639) has the molecular formula C8H11BrF3NO4S and a molecular weight of 354.14 g/mol. Its IUPAC name is N-(1-bromo-5-methylsulfonyl-2-oxopentan-3-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1-bromo-5-methylsulfonyl-2-oxopentan-3-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 104700639 |
| Molecular Formula | C8H11BrF3NO4S |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | N-(1-bromo-5-methylsulfonyl-2-oxopentan-3-yl)-2,2,2-trifluoroacetamide |
| SMILES | CS(=O)(=O)CCC(NC(=O)C(F)(F)F)C(=O)CBr |
| InChI | InChI=1S/C8H11BrF3NO4S/c1-18(16,17)3-2-5(6(14)4-9)13-7(15)8(10,11)12/h5H,2-4H2,1H3,(H,13,15) |
| InChIKey | VGTFOQLBTYBEOW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|