C8H14BrNO4S — CID 104700629
N-(1-bromo-5-methylsulfonyl-2-oxopentan-3-yl)acetamide (PubChem CID 104700629) has the molecular formula C8H14BrNO4S and a molecular weight of 300.17 g/mol. Its IUPAC name is N-(1-bromo-5-methylsulfonyl-2-oxopentan-3-yl)acetamide.
| Compound Name | N-(1-bromo-5-methylsulfonyl-2-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 104700629 |
| Molecular Formula | C8H14BrNO4S |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | N-(1-bromo-5-methylsulfonyl-2-oxopentan-3-yl)acetamide |
| SMILES | CC(=O)NC(CCS(C)(=O)=O)C(=O)CBr |
| InChI | InChI=1S/C8H14BrNO4S/c1-6(11)10-7(8(12)5-9)3-4-15(2,13)14/h7H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | HDUXSZUJXXDPQV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|