C8H15NO5S2 — CID 13048615
4-methylsulfonyl-2-(2-sulfanylpropanoylamino)butanoic acid (PubChem CID 13048615) has the molecular formula C8H15NO5S2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-methylsulfonyl-2-(2-sulfanylpropanoylamino)butanoic acid.
| Compound Name | 4-methylsulfonyl-2-(2-sulfanylpropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 13048615 |
| Molecular Formula | C8H15NO5S2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-methylsulfonyl-2-(2-sulfanylpropanoylamino)butanoic acid |
| SMILES | CC(S)C(=O)NC(CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C8H15NO5S2/c1-5(15)7(10)9-6(8(11)12)3-4-16(2,13)14/h5-6,15H,3-4H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | BMSUCZFFCUFOKL-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|