C8H14N2O4S — CID 142184881
(2S)-5-amino-5-oxo-2-[[(2S)-2-sulfanylpropanoyl]amino]pentanoic acid (PubChem CID 142184881) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-[[(2S)-2-sulfanylpropanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-[[(2S)-2-sulfanylpropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 142184881 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-[[(2S)-2-sulfanylpropanoyl]amino]pentanoic acid |
| SMILES | C[C@H](S)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H14N2O4S/c1-4(15)7(12)10-5(8(13)14)2-3-6(9)11/h4-5,15H,2-3H2,1H3,(H2,9,11)(H,10,12)(H,13,14)/t4-,5-/m0/s1 |
| InChIKey | SZUNTBHLYPHMTO-WHFBIAKZSA-N |
| XLogP | -0.86 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|