About 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride
1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride (PubChem CID 84707964) has the molecular formula C5H7ClF3NO3S
and a molecular weight of 253.63 g/mol. Its IUPAC name is 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride.
Analyze 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride?
The IUPAC name of 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride (CID 84707964) is 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride.
What is the SMILES notation for 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride?
The canonical SMILES for 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride is CC(CNC(=O)C(F)(F)F)S(=O)(=O)Cl.
What is the InChIKey of 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride?
The InChIKey is XELRMFXCYYAGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClF3NO3S/c1-3(14(6,12)13)2-10-4(11)5(7,8)9/h3H,2H2,1H3,(H,10,11).
What are the key properties of 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride?
1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride has a molecular weight of 253.63 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2,2-trifluoroacetyl)amino]propane-2-sulfonyl chloride is sourced from PubChem (CID 84707964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).