C10H18F3NO — CID 115190376
2,2,2-trifluoro-N-(2,2,4-trimethylpentyl)acetamide (PubChem CID 115190376) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2,2,4-trimethylpentyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2,2,4-trimethylpentyl)acetamide |
|---|---|
| PubChem CID | 115190376 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2,2,2-trifluoro-N-(2,2,4-trimethylpentyl)acetamide |
| SMILES | CC(C)CC(C)(C)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c1-7(2)5-9(3,4)6-14-8(15)10(11,12)13/h7H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | JDBDSPHBDUVGSE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |