C9H16F3NO2S — CID 170371749
N-[2,2-dimethyl-3-(methylsulfanylmethoxy)propyl]-2,2,2-trifluoroacetamide (PubChem CID 170371749) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(methylsulfanylmethoxy)propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2,2-dimethyl-3-(methylsulfanylmethoxy)propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170371749 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-[2,2-dimethyl-3-(methylsulfanylmethoxy)propyl]-2,2,2-trifluoroacetamide |
| SMILES | CSCOCC(C)(C)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2S/c1-8(2,5-15-6-16-3)4-13-7(14)9(10,11)12/h4-6H2,1-3H3,(H,13,14) |
| InChIKey | DPZOVBGSCFQYNG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|