C14H27NO3 — CID 115141799
tert-butyl 2-oxo-2-(2,2,4-trimethylpentylamino)acetate (PubChem CID 115141799) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is tert-butyl 2-oxo-2-(2,2,4-trimethylpentylamino)acetate.
| Compound Name | tert-butyl 2-oxo-2-(2,2,4-trimethylpentylamino)acetate |
|---|---|
| PubChem CID | 115141799 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | tert-butyl 2-oxo-2-(2,2,4-trimethylpentylamino)acetate |
| SMILES | CC(C)CC(C)(C)CNC(=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27NO3/c1-10(2)8-14(6,7)9-15-11(16)12(17)18-13(3,4)5/h10H,8-9H2,1-7H3,(H,15,16) |
| InChIKey | UDLCRXGPJCCLBX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|