C7H13F3N2O2 — CID 130913971
N-(2-aminooxy-3-methylbutyl)-2,2,2-trifluoroacetamide (PubChem CID 130913971) has the molecular formula C7H13F3N2O2 and a molecular weight of 214.19 g/mol. Its IUPAC name is N-(2-aminooxy-3-methylbutyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-aminooxy-3-methylbutyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 130913971 |
| Molecular Formula | C7H13F3N2O2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(2-aminooxy-3-methylbutyl)-2,2,2-trifluoroacetamide |
| SMILES | CC(C)C(CNC(=O)C(F)(F)F)ON |
| InChI | InChI=1S/C7H13F3N2O2/c1-4(2)5(14-11)3-12-6(13)7(8,9)10/h4-5H,3,11H2,1-2H3,(H,12,13) |
| InChIKey | VUPXTQUTQSQACJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|