About methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one
methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one (PubChem CID 159361320) has the molecular formula C14H30O2
and a molecular weight of 230.39 g/mol. Its IUPAC name is methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one.
Molecular Properties
| Compound Name | methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one |
| PubChem CID | 159361320 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one |
| SMILES | C.CC(=O)C(C)C.CC(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C8H16O.C5H10O.CH4/c1-6(2)7(9)8(3,4)5;1-4(2)5(3)6;/h6H,1-5H3;4H,1-3H3;1H4 |
| InChIKey | LIOPHQQQYXRXNY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one?
The IUPAC name of methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one (CID 159361320) is methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one.
What is the SMILES notation for methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one?
The canonical SMILES for methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one is C.CC(=O)C(C)C.CC(C)C(=O)C(C)(C)C.
What is the InChIKey of methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one?
The InChIKey is LIOPHQQQYXRXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C5H10O.CH4/c1-6(2)7(9)8(3,4)5;1-4(2)5(3)6;/h6H,1-5H3;4H,1-3H3;1H4.
What are the key properties of methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one?
methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one has a molecular weight of 230.39 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methylbutan-2-one;2,2,4-trimethylpentan-3-one is sourced from PubChem (CID 159361320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).