C11H22O — CID 12642535
2,4,4,5,5-pentamethylhexan-3-one (PubChem CID 12642535) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,4,4,5,5-pentamethylhexan-3-one.
| Compound Name | 2,4,4,5,5-pentamethylhexan-3-one |
|---|---|
| PubChem CID | 12642535 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 2,4,4,5,5-pentamethylhexan-3-one |
| SMILES | CC(C)C(=O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H22O/c1-8(2)9(12)11(6,7)10(3,4)5/h8H,1-7H3 |
| InChIKey | ZZFNRBCCYRXMMN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |