C9H19NO2 — CID 135136590
5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one (PubChem CID 135136590) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one.
| Compound Name | 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one |
|---|---|
| PubChem CID | 135136590 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one |
| SMILES | CC(C)C(=O)C(C)(O)C(C)(C)N |
| InChI | InChI=1S/C9H19NO2/c1-6(2)7(11)9(5,12)8(3,4)10/h6,12H,10H2,1-5H3 |
| InChIKey | KUNAVGXHSRKPEV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |