About 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one
5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one (PubChem CID 135136590) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one.
Molecular Properties
| Compound Name | 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one |
| PubChem CID | 135136590 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one |
| SMILES | CC(C)C(=O)C(C)(O)C(C)(C)N |
| InChI | InChI=1S/C9H19NO2/c1-6(2)7(11)9(5,12)8(3,4)10/h6,12H,10H2,1-5H3 |
| InChIKey | KUNAVGXHSRKPEV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one?
The IUPAC name of 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one (CID 135136590) is 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one.
What is the SMILES notation for 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one?
The canonical SMILES for 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one is CC(C)C(=O)C(C)(O)C(C)(C)N.
What is the InChIKey of 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one?
The InChIKey is KUNAVGXHSRKPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-6(2)7(11)9(5,12)8(3,4)10/h6,12H,10H2,1-5H3.
What are the key properties of 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one?
5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one has a molecular weight of 173.26 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-hydroxy-2,4,5-trimethylhexan-3-one is sourced from PubChem (CID 135136590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).