C12H24N2O4 — CID 163545555
2,5-bis(2-aminopropan-2-yloxy)hexane-3,4-dione (PubChem CID 163545555) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2,5-bis(2-aminopropan-2-yloxy)hexane-3,4-dione.
| Compound Name | 2,5-bis(2-aminopropan-2-yloxy)hexane-3,4-dione |
|---|---|
| PubChem CID | 163545555 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2,5-bis(2-aminopropan-2-yloxy)hexane-3,4-dione |
| SMILES | CC(OC(C)(C)N)C(=O)C(=O)C(C)OC(C)(C)N |
| InChI | InChI=1S/C12H24N2O4/c1-7(17-11(3,4)13)9(15)10(16)8(2)18-12(5,6)14/h7-8H,13-14H2,1-6H3 |
| InChIKey | FESPWADWRNNHSE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|