C15H30O3 — CID 123694757
4-methyl-2,5-bis[(2-methylpropan-2-yl)oxy]hexan-3-one (PubChem CID 123694757) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is 4-methyl-2,5-bis[(2-methylpropan-2-yl)oxy]hexan-3-one.
| Compound Name | 4-methyl-2,5-bis[(2-methylpropan-2-yl)oxy]hexan-3-one |
|---|---|
| PubChem CID | 123694757 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 4-methyl-2,5-bis[(2-methylpropan-2-yl)oxy]hexan-3-one |
| SMILES | CC(OC(C)(C)C)C(=O)C(C)C(C)OC(C)(C)C |
| InChI | InChI=1S/C15H30O3/c1-10(11(2)17-14(4,5)6)13(16)12(3)18-15(7,8)9/h10-12H,1-9H3 |
| InChIKey | RSEVKILFLJWDLH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |