C12H21NO3 — CID 121014764
2,2,4,4,6-pentamethyl-3,5-dioxoheptanamide (PubChem CID 121014764) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2,2,4,4,6-pentamethyl-3,5-dioxoheptanamide.
| Compound Name | 2,2,4,4,6-pentamethyl-3,5-dioxoheptanamide |
|---|---|
| PubChem CID | 121014764 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2,2,4,4,6-pentamethyl-3,5-dioxoheptanamide |
| SMILES | CC(C)C(=O)C(C)(C)C(=O)C(C)(C)C(N)=O |
| InChI | InChI=1S/C12H21NO3/c1-7(2)8(14)11(3,4)9(15)12(5,6)10(13)16/h7H,1-6H3,(H2,13,16) |
| InChIKey | TUVJNSDDBJVWCC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|