C20H34N2O4 — CID 3056457
2,2,4-trimethyl-1-[4-(2,2,4-trimethyl-3-oxopentanoyl)piperazin-1-yl]pentane-1,3-dione (PubChem CID 3056457) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2,2,4-trimethyl-1-[4-(2,2,4-trimethyl-3-oxopentanoyl)piperazin-1-yl]pentane-1,3-dione.
| Compound Name | 2,2,4-trimethyl-1-[4-(2,2,4-trimethyl-3-oxopentanoyl)piperazin-1-yl]pentane-1,3-dione |
|---|---|
| PubChem CID | 3056457 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2,2,4-trimethyl-1-[4-(2,2,4-trimethyl-3-oxopentanoyl)piperazin-1-yl]pentane-1,3-dione |
| SMILES | CC(C)C(=O)C(C)(C)C(=O)N1CCN(C(=O)C(C)(C)C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C20H34N2O4/c1-13(2)15(23)19(5,6)17(25)21-9-11-22(12-10-21)18(26)20(7,8)16(24)14(3)4/h13-14H,9-12H2,1-8H3 |
| InChIKey | DSSBDBBSOUYIGJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|