C16H29N3O3 — CID 108961221
3-(4-acetylpiperazin-1-yl)-2,2-dimethyl-N-(3-methylbutyl)-3-oxopropanamide (PubChem CID 108961221) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)-2,2-dimethyl-N-(3-methylbutyl)-3-oxopropanamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)-2,2-dimethyl-N-(3-methylbutyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108961221 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)-2,2-dimethyl-N-(3-methylbutyl)-3-oxopropanamide |
| SMILES | CC(=O)N1CCN(C(=O)C(C)(C)C(=O)NCCC(C)C)CC1 |
| InChI | InChI=1S/C16H29N3O3/c1-12(2)6-7-17-14(21)16(4,5)15(22)19-10-8-18(9-11-19)13(3)20/h12H,6-11H2,1-5H3,(H,17,21) |
| InChIKey | KITZKVJLPJYWCT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|