C18H33N3O4 — CID 108965291
ethyl 4-[[2,2-dimethyl-3-(3-methylbutylamino)-3-oxopropanoyl]amino]piperidine-1-carboxylate (PubChem CID 108965291) has the molecular formula C18H33N3O4 and a molecular weight of 355.48 g/mol. Its IUPAC name is ethyl 4-[[2,2-dimethyl-3-(3-methylbutylamino)-3-oxopropanoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2,2-dimethyl-3-(3-methylbutylamino)-3-oxopropanoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108965291 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | ethyl 4-[[2,2-dimethyl-3-(3-methylbutylamino)-3-oxopropanoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C(C)(C)C(=O)NCCC(C)C)CC1 |
| InChI | InChI=1S/C18H33N3O4/c1-6-25-17(24)21-11-8-14(9-12-21)20-16(23)18(4,5)15(22)19-10-7-13(2)3/h13-14H,6-12H2,1-5H3,(H,19,22)(H,20,23) |
| InChIKey | ACFLNLXSIRHZBW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|