C15H27N3O4 — CID 108957032
ethyl 4-[2,2-dimethyl-3-oxo-3-(propylamino)propanoyl]piperazine-1-carboxylate (PubChem CID 108957032) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl 4-[2,2-dimethyl-3-oxo-3-(propylamino)propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2,2-dimethyl-3-oxo-3-(propylamino)propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108957032 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | ethyl 4-[2,2-dimethyl-3-oxo-3-(propylamino)propanoyl]piperazine-1-carboxylate |
| SMILES | CCCNC(=O)C(C)(C)C(=O)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C15H27N3O4/c1-5-7-16-12(19)15(3,4)13(20)17-8-10-18(11-9-17)14(21)22-6-2/h5-11H2,1-4H3,(H,16,19) |
| InChIKey | RFTVTMCIMZVZSY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|